(2S,3S)-2-(1H-indole-5-carbonylamino)-3-methylpentanoic acid

C15H18N2O3 — CID 7096551

IUPAC(2S,3S)-2-(1H-indole-5-carbonylamino)-3-methylpentanoic acid
SMILESCC[C@H](C)[C@H](NC(=O)c1ccc2[nH]ccc2c1)C(=O)O
InChIInChI=1S/C15H18N2O3/c1-3-9(2)13(15(19)20)17-14(18)11-4-5-12-10(8-11)6-7-16-12/h4-9,13,16H,3H2,1-2H3,(H,17,18)(H,19,20)/t9-,13-/m0/s1
InChIKeyGEKSEHFBMPYXLS-ZANVPECISA-N
MW274.32 g/mol
LogP2.40
Rot. Bonds5

About (2S,3S)-2-(1H-indole-5-carbonylamino)-3-methylpentanoic acid

(2S,3S)-2-(1H-indole-5-carbonylamino)-3-methylpentanoic acid (PubChem CID 7096551) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (2S,3S)-2-(1H-indole-5-carbonylamino)-3-methylpentanoic acid.

Molecular Properties

Compound Name(2S,3S)-2-(1H-indole-5-carbonylamino)-3-methylpentanoic acid
PubChem CID7096551
Molecular FormulaC15H18N2O3
Molecular Weight274.32 g/mol
Exact Mass274.13
IUPAC Name(2S,3S)-2-(1H-indole-5-carbonylamino)-3-methylpentanoic acid
SMILESCC[C@H](C)[C@H](NC(=O)c1ccc2[nH]ccc2c1)C(=O)O
InChIInChI=1S/C15H18N2O3/c1-3-9(2)13(15(19)20)17-14(18)11-4-5-12-10(8-11)6-7-16-12/h4-9,13,16H,3H2,1-2H3,(H,17,18)(H,19,20)/t9-,13-/m0/s1
InChIKeyGEKSEHFBMPYXLS-ZANVPECISA-N
XLogP2.40
TPSA82.19 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.32
LogP ≤ 52.40
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze (2S,3S)-2-(1H-indole-5-carbonylamino)-3-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3S)-2-(1H-indole-5-carbonylamino)-3-methylpentanoic acid?
The IUPAC name of (2S,3S)-2-(1H-indole-5-carbonylamino)-3-methylpentanoic acid (CID 7096551) is (2S,3S)-2-(1H-indole-5-carbonylamino)-3-methylpentanoic acid.
What is the SMILES notation for (2S,3S)-2-(1H-indole-5-carbonylamino)-3-methylpentanoic acid?
The canonical SMILES for (2S,3S)-2-(1H-indole-5-carbonylamino)-3-methylpentanoic acid is CC[C@H](C)[C@H](NC(=O)c1ccc2[nH]ccc2c1)C(=O)O.
What is the InChIKey of (2S,3S)-2-(1H-indole-5-carbonylamino)-3-methylpentanoic acid?
The InChIKey is GEKSEHFBMPYXLS-ZANVPECISA-N. The full InChI is InChI=1S/C15H18N2O3/c1-3-9(2)13(15(19)20)17-14(18)11-4-5-12-10(8-11)6-7-16-12/h4-9,13,16H,3H2,1-2H3,(H,17,18)(H,19,20)/t9-,13-/m0/s1.
What are the key properties of (2S,3S)-2-(1H-indole-5-carbonylamino)-3-methylpentanoic acid?
(2S,3S)-2-(1H-indole-5-carbonylamino)-3-methylpentanoic acid has a molecular weight of 274.32 g/mol, XLogP of 2.40, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-(1H-indole-5-carbonylamino)-3-methylpentanoic acid is sourced from PubChem (CID 7096551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).