C16H20N2O3 — CID 95357359
methyl (2R,3R)-2-(1H-indole-6-carbonylamino)-3-methylpentanoate (PubChem CID 95357359) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is methyl (2R,3R)-2-(1H-indole-6-carbonylamino)-3-methylpentanoate.
| Compound Name | methyl (2R,3R)-2-(1H-indole-6-carbonylamino)-3-methylpentanoate |
|---|---|
| PubChem CID | 95357359 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | methyl (2R,3R)-2-(1H-indole-6-carbonylamino)-3-methylpentanoate |
| SMILES | CC[C@@H](C)[C@@H](NC(=O)c1ccc2cc[nH]c2c1)C(=O)OC |
| InChI | InChI=1S/C16H20N2O3/c1-4-10(2)14(16(20)21-3)18-15(19)12-6-5-11-7-8-17-13(11)9-12/h5-10,14,17H,4H2,1-3H3,(H,18,19)/t10-,14-/m1/s1 |
| InChIKey | RVLPHUCMYDZCDC-QMTHXVAHSA-N |
| XLogP | 2.49 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |