C20H21N3O2 — CID 174381341
1H-indole;3-(1H-indol-3-yl)-2-(methylamino)propanoic acid (PubChem CID 174381341) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 1H-indole;3-(1H-indol-3-yl)-2-(methylamino)propanoic acid.
| Compound Name | 1H-indole;3-(1H-indol-3-yl)-2-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 174381341 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1H-indole;3-(1H-indol-3-yl)-2-(methylamino)propanoic acid |
| SMILES | CNC(Cc1c[nH]c2ccccc12)C(=O)O.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C12H14N2O2.C8H7N/c1-13-11(12(15)16)6-8-7-14-10-5-3-2-4-9(8)10;1-2-4-8-7(3-1)5-6-9-8/h2-5,7,11,13-14H,6H2,1H3,(H,15,16);1-6,9H |
| InChIKey | JBRMUONTEPSIAW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |