About (2-bromo-4-chlorophenyl) 2-(1H-indol-3-yl)acetate
(2-bromo-4-chlorophenyl) 2-(1H-indol-3-yl)acetate (PubChem CID 26212995) has the molecular formula C16H11BrClNO2
and a molecular weight of 364.63 g/mol. Its IUPAC name is (2-bromo-4-chlorophenyl) 2-(1H-indol-3-yl)acetate.
Molecular Properties
| Compound Name | (2-bromo-4-chlorophenyl) 2-(1H-indol-3-yl)acetate |
| PubChem CID | 26212995 |
| Molecular Formula | C16H11BrClNO2 |
| Molecular Weight | 364.63 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | (2-bromo-4-chlorophenyl) 2-(1H-indol-3-yl)acetate |
| SMILES | O=C(Cc1c[nH]c2ccccc12)Oc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C16H11BrClNO2/c17-13-8-11(18)5-6-15(13)21-16(20)7-10-9-19-14-4-2-1-3-12(10)14/h1-6,8-9,19H,7H2 |
| InChIKey | LAFWXJJAZZPIJK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-4-chlorophenyl) 2-(1H-indol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-4-chlorophenyl) 2-(1H-indol-3-yl)acetate?
The IUPAC name of (2-bromo-4-chlorophenyl) 2-(1H-indol-3-yl)acetate (CID 26212995) is (2-bromo-4-chlorophenyl) 2-(1H-indol-3-yl)acetate.
What is the SMILES notation for (2-bromo-4-chlorophenyl) 2-(1H-indol-3-yl)acetate?
The canonical SMILES for (2-bromo-4-chlorophenyl) 2-(1H-indol-3-yl)acetate is O=C(Cc1c[nH]c2ccccc12)Oc1ccc(Cl)cc1Br.
What is the InChIKey of (2-bromo-4-chlorophenyl) 2-(1H-indol-3-yl)acetate?
The InChIKey is LAFWXJJAZZPIJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11BrClNO2/c17-13-8-11(18)5-6-15(13)21-16(20)7-10-9-19-14-4-2-1-3-12(10)14/h1-6,8-9,19H,7H2.
What are the key properties of (2-bromo-4-chlorophenyl) 2-(1H-indol-3-yl)acetate?
(2-bromo-4-chlorophenyl) 2-(1H-indol-3-yl)acetate has a molecular weight of 364.63 g/mol, XLogP of 4.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-4-chlorophenyl) 2-(1H-indol-3-yl)acetate is sourced from PubChem (CID 26212995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).