C24H28N2O5 — CID 9017608
[2-[(4-ethoxy-3-methoxyphenyl)methyl-ethylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate (PubChem CID 9017608) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is [2-[(4-ethoxy-3-methoxyphenyl)methyl-ethylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate.
| Compound Name | [2-[(4-ethoxy-3-methoxyphenyl)methyl-ethylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 9017608 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | [2-[(4-ethoxy-3-methoxyphenyl)methyl-ethylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
| SMILES | CCOc1ccc(CN(CC)C(=O)COC(=O)Cc2c[nH]c3ccccc23)cc1OC |
| InChI | InChI=1S/C24H28N2O5/c1-4-26(15-17-10-11-21(30-5-2)22(12-17)29-3)23(27)16-31-24(28)13-18-14-25-20-9-7-6-8-19(18)20/h6-12,14,25H,4-5,13,15-16H2,1-3H3 |
| InChIKey | XIDQSFJEADYMSX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |