C15H23N3OS2 — CID 9220301
1-[[2-(4-methylphenyl)sulfanylacetyl]amino]-3-pentylthiourea (PubChem CID 9220301) has the molecular formula C15H23N3OS2 and a molecular weight of 325.50 g/mol. Its IUPAC name is 1-[[2-(4-methylphenyl)sulfanylacetyl]amino]-3-pentylthiourea.
| Compound Name | 1-[[2-(4-methylphenyl)sulfanylacetyl]amino]-3-pentylthiourea |
|---|---|
| PubChem CID | 9220301 |
| Molecular Formula | C15H23N3OS2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 1-[[2-(4-methylphenyl)sulfanylacetyl]amino]-3-pentylthiourea |
| SMILES | CCCCCNC(=S)NNC(=O)CSc1ccc(C)cc1 |
| InChI | InChI=1S/C15H23N3OS2/c1-3-4-5-10-16-15(20)18-17-14(19)11-21-13-8-6-12(2)7-9-13/h6-9H,3-5,10-11H2,1-2H3,(H,17,19)(H2,16,18,20) |
| InChIKey | YWIXBWGUKYKHJT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|