C21H27N3O5S — CID 52920763
2-[4-(benzenesulfonyl)-1,4-diazepan-1-yl]-N-(2,4-dimethoxyphenyl)acetamide (PubChem CID 52920763) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)-1,4-diazepan-1-yl]-N-(2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[4-(benzenesulfonyl)-1,4-diazepan-1-yl]-N-(2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 52920763 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 2-[4-(benzenesulfonyl)-1,4-diazepan-1-yl]-N-(2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2CCCN(S(=O)(=O)c3ccccc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C21H27N3O5S/c1-28-17-9-10-19(20(15-17)29-2)22-21(25)16-23-11-6-12-24(14-13-23)30(26,27)18-7-4-3-5-8-18/h3-5,7-10,15H,6,11-14,16H2,1-2H3,(H,22,25) |
| InChIKey | SZFWDYHEJWGXNB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |