C18H23ClN4O3S — CID 46462504
3-(tert-butylsulfamoyl)-4-chloro-N-[6-(dimethylamino)-3-pyridinyl]benzamide (PubChem CID 46462504) has the molecular formula C18H23ClN4O3S and a molecular weight of 410.93 g/mol. Its IUPAC name is 3-(tert-butylsulfamoyl)-4-chloro-N-[6-(dimethylamino)-3-pyridinyl]benzamide.
| Compound Name | 3-(tert-butylsulfamoyl)-4-chloro-N-[6-(dimethylamino)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 46462504 |
| Molecular Formula | C18H23ClN4O3S |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 3-(tert-butylsulfamoyl)-4-chloro-N-[6-(dimethylamino)-3-pyridinyl]benzamide |
| SMILES | CN(C)c1ccc(NC(=O)c2ccc(Cl)c(S(=O)(=O)NC(C)(C)C)c2)cn1 |
| InChI | InChI=1S/C18H23ClN4O3S/c1-18(2,3)22-27(25,26)15-10-12(6-8-14(15)19)17(24)21-13-7-9-16(20-11-13)23(4)5/h6-11,22H,1-5H3,(H,21,24) |
| InChIKey | RQZCVBZGWYOYPJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |