C21H23BrN2O5S — CID 25374190
N-[3-[(3-bromo-4-methoxyphenyl)sulfamoyl]-4-methoxyphenyl]-2-[(1R)-cyclopent-2-en-1-yl]acetamide (PubChem CID 25374190) has the molecular formula C21H23BrN2O5S and a molecular weight of 495.40 g/mol. Its IUPAC name is N-[3-[(3-bromo-4-methoxyphenyl)sulfamoyl]-4-methoxyphenyl]-2-[(1R)-cyclopent-2-en-1-yl]acetamide.
| Compound Name | N-[3-[(3-bromo-4-methoxyphenyl)sulfamoyl]-4-methoxyphenyl]-2-[(1R)-cyclopent-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 25374190 |
| Molecular Formula | C21H23BrN2O5S |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | N-[3-[(3-bromo-4-methoxyphenyl)sulfamoyl]-4-methoxyphenyl]-2-[(1R)-cyclopent-2-en-1-yl]acetamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)C[C@@H]3C=CCC3)ccc2OC)cc1Br |
| InChI | InChI=1S/C21H23BrN2O5S/c1-28-18-9-8-16(12-17(18)22)24-30(26,27)20-13-15(7-10-19(20)29-2)23-21(25)11-14-5-3-4-6-14/h3,5,7-10,12-14,24H,4,6,11H2,1-2H3,(H,23,25)/t14-/m1/s1 |
| InChIKey | QBYLHUDVNLAQEH-CQSZACIVSA-N |
| XLogP | 4.56 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|