C20H21ClN2O4S — CID 9322651
N-[3-[(4-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-2-[(1S)-cyclopent-2-en-1-yl]acetamide (PubChem CID 9322651) has the molecular formula C20H21ClN2O4S and a molecular weight of 420.92 g/mol. Its IUPAC name is N-[3-[(4-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-2-[(1S)-cyclopent-2-en-1-yl]acetamide.
| Compound Name | N-[3-[(4-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-2-[(1S)-cyclopent-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 9322651 |
| Molecular Formula | C20H21ClN2O4S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N-[3-[(4-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-2-[(1S)-cyclopent-2-en-1-yl]acetamide |
| SMILES | COc1ccc(NC(=O)C[C@H]2C=CCC2)cc1S(=O)(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21ClN2O4S/c1-27-18-11-10-17(22-20(24)12-14-4-2-3-5-14)13-19(18)28(25,26)23-16-8-6-15(21)7-9-16/h2,4,6-11,13-14,23H,3,5,12H2,1H3,(H,22,24)/t14-/m0/s1 |
| InChIKey | YLLLPWWGHRXUHK-AWEZNQCLSA-N |
| XLogP | 4.44 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|