C25H22BrN3O5S — CID 4195705
N-[3-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]-2-cyano-3-phenylprop-2-enamide (PubChem CID 4195705) has the molecular formula C25H22BrN3O5S and a molecular weight of 556.44 g/mol. Its IUPAC name is N-[3-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]-2-cyano-3-phenylprop-2-enamide.
| Compound Name | N-[3-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]-2-cyano-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 4195705 |
| Molecular Formula | C25H22BrN3O5S |
| Molecular Weight | 556.44 g/mol |
| Exact Mass | 555.05 |
| IUPAC Name | N-[3-[(3-bromo-4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]-2-cyano-3-phenylprop-2-enamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2cc(NC(=O)C(C#N)=Cc3ccccc3)ccc2OC)cc1Br |
| InChI | InChI=1S/C25H22BrN3O5S/c1-3-34-22-11-10-20(14-21(22)26)29-35(31,32)24-15-19(9-12-23(24)33-2)28-25(30)18(16-27)13-17-7-5-4-6-8-17/h4-15,29H,3H2,1-2H3,(H,28,30) |
| InChIKey | CALVTILDSNDTAR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.44 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|