C17H23BrN2O2 — CID 120989691
9-amino-N-(3-bromo-4-methoxyphenyl)bicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 120989691) has the molecular formula C17H23BrN2O2 and a molecular weight of 367.29 g/mol. Its IUPAC name is 9-amino-N-(3-bromo-4-methoxyphenyl)bicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | 9-amino-N-(3-bromo-4-methoxyphenyl)bicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 120989691 |
| Molecular Formula | C17H23BrN2O2 |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 9-amino-N-(3-bromo-4-methoxyphenyl)bicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CC3CCCC(C2)C3N)cc1Br |
| InChI | InChI=1S/C17H23BrN2O2/c1-22-15-6-5-13(9-14(15)18)20-17(21)12-7-10-3-2-4-11(8-12)16(10)19/h5-6,9-12,16H,2-4,7-8,19H2,1H3,(H,20,21) |
| InChIKey | VDAHUUAWQQBOOW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |