C19H27BrN2O2 — CID 120984029
9-amino-N-[1-(3-bromo-4-methoxyphenyl)ethyl]bicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 120984029) has the molecular formula C19H27BrN2O2 and a molecular weight of 395.34 g/mol. Its IUPAC name is 9-amino-N-[1-(3-bromo-4-methoxyphenyl)ethyl]bicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | 9-amino-N-[1-(3-bromo-4-methoxyphenyl)ethyl]bicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 120984029 |
| Molecular Formula | C19H27BrN2O2 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 9-amino-N-[1-(3-bromo-4-methoxyphenyl)ethyl]bicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | COc1ccc(C(C)NC(=O)C2CC3CCCC(C2)C3N)cc1Br |
| InChI | InChI=1S/C19H27BrN2O2/c1-11(12-6-7-17(24-2)16(20)10-12)22-19(23)15-8-13-4-3-5-14(9-15)18(13)21/h6-7,10-11,13-15,18H,3-5,8-9,21H2,1-2H3,(H,22,23) |
| InChIKey | KKPNOVQZBGANRA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |