C19H27FN2O3S — CID 120991008
9-amino-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]bicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 120991008) has the molecular formula C19H27FN2O3S and a molecular weight of 382.50 g/mol. Its IUPAC name is 9-amino-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]bicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | 9-amino-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]bicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 120991008 |
| Molecular Formula | C19H27FN2O3S |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 9-amino-N-[1-(3-fluoro-4-methylsulfonylphenyl)ethyl]bicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | CC(NC(=O)C1CC2CCCC(C1)C2N)c1ccc(S(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C19H27FN2O3S/c1-11(12-6-7-17(16(20)10-12)26(2,24)25)22-19(23)15-8-13-4-3-5-14(9-15)18(13)21/h6-7,10-11,13-15,18H,3-5,8-9,21H2,1-2H3,(H,22,23) |
| InChIKey | HRPZKIOPHZQVCA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |