C19H23N3O5S — CID 18409174
(E)-N-[2-[4-(2-methoxyethoxy)-3-sulfamoylphenyl]ethyl]-3-pyridin-2-ylprop-2-enamide (PubChem CID 18409174) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is (E)-N-[2-[4-(2-methoxyethoxy)-3-sulfamoylphenyl]ethyl]-3-pyridin-2-ylprop-2-enamide.
| Compound Name | (E)-N-[2-[4-(2-methoxyethoxy)-3-sulfamoylphenyl]ethyl]-3-pyridin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 18409174 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | (E)-N-[2-[4-(2-methoxyethoxy)-3-sulfamoylphenyl]ethyl]-3-pyridin-2-ylprop-2-enamide |
| SMILES | COCCOc1ccc(CCNC(=O)/C=C/c2ccccn2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C19H23N3O5S/c1-26-12-13-27-17-7-5-15(14-18(17)28(20,24)25)9-11-22-19(23)8-6-16-4-2-3-10-21-16/h2-8,10,14H,9,11-13H2,1H3,(H,22,23)(H2,20,24,25)/b8-6+ |
| InChIKey | KZIYLSIHYUURHG-SOFGYWHQSA-N |
| XLogP | 1.13 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|