C19H24N2O5S2 — CID 18409151
(E)-N-[2-[4-(2-ethoxyethoxy)-3-sulfamoylphenyl]ethyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 18409151) has the molecular formula C19H24N2O5S2 and a molecular weight of 424.54 g/mol. Its IUPAC name is (E)-N-[2-[4-(2-ethoxyethoxy)-3-sulfamoylphenyl]ethyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[2-[4-(2-ethoxyethoxy)-3-sulfamoylphenyl]ethyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 18409151 |
| Molecular Formula | C19H24N2O5S2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | (E)-N-[2-[4-(2-ethoxyethoxy)-3-sulfamoylphenyl]ethyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCOCCOc1ccc(CCNC(=O)/C=C/c2cccs2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C19H24N2O5S2/c1-2-25-11-12-26-17-7-5-15(14-18(17)28(20,23)24)9-10-21-19(22)8-6-16-4-3-13-27-16/h3-8,13-14H,2,9-12H2,1H3,(H,21,22)(H2,20,23,24)/b8-6+ |
| InChIKey | KCLQOAJUYJKCKC-SOFGYWHQSA-N |
| XLogP | 2.18 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|