C18H21N3O5S3 — CID 90766291
N-[2-[4-methoxy-3-[methylcarbamoyl(sulfanyl)sulfamoyl]phenyl]ethyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 90766291) has the molecular formula C18H21N3O5S3 and a molecular weight of 455.58 g/mol. Its IUPAC name is N-[2-[4-methoxy-3-[methylcarbamoyl(sulfanyl)sulfamoyl]phenyl]ethyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[2-[4-methoxy-3-[methylcarbamoyl(sulfanyl)sulfamoyl]phenyl]ethyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 90766291 |
| Molecular Formula | C18H21N3O5S3 |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | N-[2-[4-methoxy-3-[methylcarbamoyl(sulfanyl)sulfamoyl]phenyl]ethyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | CNC(=O)N(S)S(=O)(=O)c1cc(CCNC(=O)C=Cc2cccs2)ccc1OC |
| InChI | InChI=1S/C18H21N3O5S3/c1-19-18(23)21(27)29(24,25)16-12-13(5-7-15(16)26-2)9-10-20-17(22)8-6-14-4-3-11-28-14/h3-8,11-12,27H,9-10H2,1-2H3,(H,19,23)(H,20,22) |
| InChIKey | KMZYUWVAIDQGDU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|