C18H19F3N2O5S2 — CID 18409162
(E)-N-[2-[3-sulfamoyl-4-[2-(trifluoromethoxy)ethoxy]phenyl]ethyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 18409162) has the molecular formula C18H19F3N2O5S2 and a molecular weight of 464.49 g/mol. Its IUPAC name is (E)-N-[2-[3-sulfamoyl-4-[2-(trifluoromethoxy)ethoxy]phenyl]ethyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[2-[3-sulfamoyl-4-[2-(trifluoromethoxy)ethoxy]phenyl]ethyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 18409162 |
| Molecular Formula | C18H19F3N2O5S2 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | (E)-N-[2-[3-sulfamoyl-4-[2-(trifluoromethoxy)ethoxy]phenyl]ethyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | NS(=O)(=O)c1cc(CCNC(=O)/C=C/c2cccs2)ccc1OCCOC(F)(F)F |
| InChI | InChI=1S/C18H19F3N2O5S2/c19-18(20,21)28-10-9-27-15-5-3-13(12-16(15)30(22,25)26)7-8-23-17(24)6-4-14-2-1-11-29-14/h1-6,11-12H,7-10H2,(H,23,24)(H2,22,25,26)/b6-4+ |
| InChIKey | LWYHGYLCWZBIKS-GQCTYLIASA-N |
| XLogP | 2.68 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|