C23H24F2N2O4 — CID 35711392
N-cyclopropyl-4-[(E)-3-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]-3-oxoprop-1-enyl]benzamide (PubChem CID 35711392) has the molecular formula C23H24F2N2O4 and a molecular weight of 430.45 g/mol. Its IUPAC name is N-cyclopropyl-4-[(E)-3-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(E)-3-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 35711392 |
| Molecular Formula | C23H24F2N2O4 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-cyclopropyl-4-[(E)-3-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethylamino]-3-oxoprop-1-enyl]benzamide |
| SMILES | COc1cc(CCNC(=O)/C=C/c2ccc(C(=O)NC3CC3)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C23H24F2N2O4/c1-30-20-14-16(4-10-19(20)31-23(24)25)12-13-26-21(28)11-5-15-2-6-17(7-3-15)22(29)27-18-8-9-18/h2-7,10-11,14,18,23H,8-9,12-13H2,1H3,(H,26,28)(H,27,29)/b11-5+ |
| InChIKey | PSEOQMQQDJIGQQ-VZUCSPMQSA-N |
| XLogP | 3.56 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|