C19H17Cl2F2NO3 — CID 3627150
N-[2-(2,4-dichlorophenyl)ethyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide (PubChem CID 3627150) has the molecular formula C19H17Cl2F2NO3 and a molecular weight of 416.25 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 3627150 |
| Molecular Formula | C19H17Cl2F2NO3 |
| Molecular Weight | 416.25 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)NCCc2ccc(Cl)cc2Cl)ccc1OC(F)F |
| InChI | InChI=1S/C19H17Cl2F2NO3/c1-26-17-10-12(2-6-16(17)27-19(22)23)3-7-18(25)24-9-8-13-4-5-14(20)11-15(13)21/h2-7,10-11,19H,8-9H2,1H3,(H,24,25) |
| InChIKey | BAZPBHXUTMWGAU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.25 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|