C16H13ClF2N2O3 — CID 33327682
(E)-N-(5-chloro-2-pyridinyl)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide (PubChem CID 33327682) has the molecular formula C16H13ClF2N2O3 and a molecular weight of 354.74 g/mol. Its IUPAC name is (E)-N-(5-chloro-2-pyridinyl)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-N-(5-chloro-2-pyridinyl)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 33327682 |
| Molecular Formula | C16H13ClF2N2O3 |
| Molecular Weight | 354.74 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | (E)-N-(5-chloro-2-pyridinyl)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc(Cl)cn2)ccc1OC(F)F |
| InChI | InChI=1S/C16H13ClF2N2O3/c1-23-13-8-10(2-5-12(13)24-16(18)19)3-7-15(22)21-14-6-4-11(17)9-20-14/h2-9,16H,1H3,(H,20,21,22)/b7-3+ |
| InChIKey | AEUYUYGGLISQQI-XVNBXDOJSA-N |
| XLogP | 4.00 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.74 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|