C23H28N2O5S — CID 33310401
(E)-N-[3-(cyclopropylsulfamoyl)phenyl]-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide (PubChem CID 33310401) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is (E)-N-[3-(cyclopropylsulfamoyl)phenyl]-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[3-(cyclopropylsulfamoyl)phenyl]-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 33310401 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | (E)-N-[3-(cyclopropylsulfamoyl)phenyl]-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cccc(S(=O)(=O)NC3CC3)c2)ccc1OCC(C)C |
| InChI | InChI=1S/C23H28N2O5S/c1-16(2)15-30-21-11-7-17(13-22(21)29-3)8-12-23(26)24-19-5-4-6-20(14-19)31(27,28)25-18-9-10-18/h4-8,11-14,16,18,25H,9-10,15H2,1-3H3,(H,24,26)/b12-8+ |
| InChIKey | KXAWKPAHYGDYMO-XYOKQWHBSA-N |
| XLogP | 3.82 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|