C18H16N4O5 — CID 41070274
5-[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]benzene-1,3-dicarboxamide (PubChem CID 41070274) has the molecular formula C18H16N4O5 and a molecular weight of 368.35 g/mol. Its IUPAC name is 5-[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]benzene-1,3-dicarboxamide.
| Compound Name | 5-[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 41070274 |
| Molecular Formula | C18H16N4O5 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 5-[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]benzene-1,3-dicarboxamide |
| SMILES | COc1cc(C#N)ccc1OCC(=O)Nc1cc(C(N)=O)cc(C(N)=O)c1 |
| InChI | InChI=1S/C18H16N4O5/c1-26-15-4-10(8-19)2-3-14(15)27-9-16(23)22-13-6-11(17(20)24)5-12(7-13)18(21)25/h2-7H,9H2,1H3,(H2,20,24)(H2,21,25)(H,22,23) |
| InChIKey | JIOHOQJEXKMSJB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 157.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |