C26H29N3O4 — CID 41208643
2-[[2-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)acetyl]amino]-N-[(1S)-1-phenylethyl]benzamide (PubChem CID 41208643) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 2-[[2-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)acetyl]amino]-N-[(1S)-1-phenylethyl]benzamide.
| Compound Name | 2-[[2-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)acetyl]amino]-N-[(1S)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 41208643 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 2-[[2-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)acetyl]amino]-N-[(1S)-1-phenylethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccccc1NC(=O)CN1C(=O)CC2(CCCCC2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C26H29N3O4/c1-18(19-10-4-2-5-11-19)27-24(32)20-12-6-7-13-21(20)28-22(30)17-29-23(31)16-26(25(29)33)14-8-3-9-15-26/h2,4-7,10-13,18H,3,8-9,14-17H2,1H3,(H,27,32)(H,28,30)/t18-/m0/s1 |
| InChIKey | LXOQCGFRPNNSNB-SFHVURJKSA-N |
| XLogP | 3.83 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|