C27H32N4O4 — CID 51486000
2-[[2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)acetyl]amino]-N-[(1R)-1-phenylethyl]benzamide (PubChem CID 51486000) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is 2-[[2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)acetyl]amino]-N-[(1R)-1-phenylethyl]benzamide.
| Compound Name | 2-[[2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)acetyl]amino]-N-[(1R)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 51486000 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 2-[[2-(2,4-dioxo-1,3-diazaspiro[4.7]dodecan-3-yl)acetyl]amino]-N-[(1R)-1-phenylethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccccc1NC(=O)CN1C(=O)NC2(CCCCCCC2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C27H32N4O4/c1-19(20-12-6-5-7-13-20)28-24(33)21-14-8-9-15-22(21)29-23(32)18-31-25(34)27(30-26(31)35)16-10-3-2-4-11-17-27/h5-9,12-15,19H,2-4,10-11,16-18H2,1H3,(H,28,33)(H,29,32)(H,30,35)/t19-/m1/s1 |
| InChIKey | GJLAPLSEVMTZTL-LJQANCHMSA-N |
| XLogP | 4.15 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|