C18H24N3O2+ — CID 9261274
methyl-(naphthalen-2-ylmethyl)-[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl]azanium (PubChem CID 9261274) has the molecular formula C18H24N3O2+ and a molecular weight of 314.41 g/mol. Its IUPAC name is methyl-(naphthalen-2-ylmethyl)-[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl]azanium.
| Compound Name | methyl-(naphthalen-2-ylmethyl)-[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl]azanium |
|---|---|
| PubChem CID | 9261274 |
| Molecular Formula | C18H24N3O2+ |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | methyl-(naphthalen-2-ylmethyl)-[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl]azanium |
| SMILES | CC(C)NC(=O)NC(=O)C[NH+](C)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H23N3O2/c1-13(2)19-18(23)20-17(22)12-21(3)11-14-8-9-15-6-4-5-7-16(15)10-14/h4-10,13H,11-12H2,1-3H3,(H2,19,20,22,23)/p+1 |
| InChIKey | HLICCJQVQHMXKI-UHFFFAOYSA-O |
| XLogP | 1.09 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |