C20H28N3O3+ — CID 8925434
[2-(butylcarbamoylamino)-2-oxoethyl]-[(6-methoxynaphthalen-2-yl)methyl]-methylazanium (PubChem CID 8925434) has the molecular formula C20H28N3O3+ and a molecular weight of 358.46 g/mol. Its IUPAC name is [2-(butylcarbamoylamino)-2-oxoethyl]-[(6-methoxynaphthalen-2-yl)methyl]-methylazanium.
| Compound Name | [2-(butylcarbamoylamino)-2-oxoethyl]-[(6-methoxynaphthalen-2-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8925434 |
| Molecular Formula | C20H28N3O3+ |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [2-(butylcarbamoylamino)-2-oxoethyl]-[(6-methoxynaphthalen-2-yl)methyl]-methylazanium |
| SMILES | CCCCNC(=O)NC(=O)C[NH+](C)Cc1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C20H27N3O3/c1-4-5-10-21-20(25)22-19(24)14-23(2)13-15-6-7-17-12-18(26-3)9-8-16(17)11-15/h6-9,11-12H,4-5,10,13-14H2,1-3H3,(H2,21,22,24,25)/p+1 |
| InChIKey | QSDLXFSWEPYMEB-UHFFFAOYSA-O |
| XLogP | 1.49 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|