C10H10N2OS2 — CID 115287455
2-amino-2-thiophen-2-yl-N-thiophen-3-ylacetamide (PubChem CID 115287455) has the molecular formula C10H10N2OS2 and a molecular weight of 238.34 g/mol. Its IUPAC name is 2-amino-2-thiophen-2-yl-N-thiophen-3-ylacetamide.
| Compound Name | 2-amino-2-thiophen-2-yl-N-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 115287455 |
| Molecular Formula | C10H10N2OS2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 2-amino-2-thiophen-2-yl-N-thiophen-3-ylacetamide |
| SMILES | NC(C(=O)Nc1ccsc1)c1cccs1 |
| InChI | InChI=1S/C10H10N2OS2/c11-9(8-2-1-4-15-8)10(13)12-7-3-5-14-6-7/h1-6,9H,11H2,(H,12,13) |
| InChIKey | PRXMDGMKFDHOIO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |