C15H18N2OS — CID 115285827
2-amino-2-thiophen-2-yl-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 115285827) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 2-amino-2-thiophen-2-yl-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-amino-2-thiophen-2-yl-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 115285827 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-amino-2-thiophen-2-yl-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)C(N)c2cccs2)c(C)c1 |
| InChI | InChI=1S/C15H18N2OS/c1-9-7-10(2)14(11(3)8-9)17-15(18)13(16)12-5-4-6-19-12/h4-8,13H,16H2,1-3H3,(H,17,18) |
| InChIKey | RRIHMLFFFMQRIU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |