C15H16N2O3S — CID 115286394
methyl 4-[(2-amino-2-thiophen-2-ylacetyl)amino]-3-methylbenzoate (PubChem CID 115286394) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is methyl 4-[(2-amino-2-thiophen-2-ylacetyl)amino]-3-methylbenzoate.
| Compound Name | methyl 4-[(2-amino-2-thiophen-2-ylacetyl)amino]-3-methylbenzoate |
|---|---|
| PubChem CID | 115286394 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | methyl 4-[(2-amino-2-thiophen-2-ylacetyl)amino]-3-methylbenzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C(N)c2cccs2)c(C)c1 |
| InChI | InChI=1S/C15H16N2O3S/c1-9-8-10(15(19)20-2)5-6-11(9)17-14(18)13(16)12-4-3-7-21-12/h3-8,13H,16H2,1-2H3,(H,17,18) |
| InChIKey | MTZDSUIVHHDAIR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |