C25H26ClN5O2 — CID 42857231
1-[6-[4-(3-chlorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-(2,5-dimethylphenyl)urea (PubChem CID 42857231) has the molecular formula C25H26ClN5O2 and a molecular weight of 463.97 g/mol. Its IUPAC name is 1-[6-[4-(3-chlorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-(2,5-dimethylphenyl)urea.
| Compound Name | 1-[6-[4-(3-chlorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-(2,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 42857231 |
| Molecular Formula | C25H26ClN5O2 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 1-[6-[4-(3-chlorobenzoyl)piperazin-1-yl]-3-pyridinyl]-3-(2,5-dimethylphenyl)urea |
| SMILES | Cc1ccc(C)c(NC(=O)Nc2ccc(N3CCN(C(=O)c4cccc(Cl)c4)CC3)nc2)c1 |
| InChI | InChI=1S/C25H26ClN5O2/c1-17-6-7-18(2)22(14-17)29-25(33)28-21-8-9-23(27-16-21)30-10-12-31(13-11-30)24(32)19-4-3-5-20(26)15-19/h3-9,14-16H,10-13H2,1-2H3,(H2,28,29,33) |
| InChIKey | JATPQFVQXXRSOV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |