C23H29FN4O2 — CID 1065117
N-[(2S)-butan-2-yl]-5-[(3-fluorophenyl)carbamoylamino]-2-piperidin-1-ylbenzamide (PubChem CID 1065117) has the molecular formula C23H29FN4O2 and a molecular weight of 412.51 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-5-[(3-fluorophenyl)carbamoylamino]-2-piperidin-1-ylbenzamide.
| Compound Name | N-[(2S)-butan-2-yl]-5-[(3-fluorophenyl)carbamoylamino]-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1065117 |
| Molecular Formula | C23H29FN4O2 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | N-[(2S)-butan-2-yl]-5-[(3-fluorophenyl)carbamoylamino]-2-piperidin-1-ylbenzamide |
| SMILES | CC[C@H](C)NC(=O)c1cc(NC(=O)Nc2cccc(F)c2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C23H29FN4O2/c1-3-16(2)25-22(29)20-15-19(10-11-21(20)28-12-5-4-6-13-28)27-23(30)26-18-9-7-8-17(24)14-18/h7-11,14-16H,3-6,12-13H2,1-2H3,(H,25,29)(H2,26,27,30)/t16-/m0/s1 |
| InChIKey | YSXNNHBQTJUQDV-INIZCTEOSA-N |
| XLogP | 4.99 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|