C24H32N4O2 — CID 3707100
N-butan-2-yl-5-[(4-ethylphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide (PubChem CID 3707100) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is N-butan-2-yl-5-[(4-ethylphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-butan-2-yl-5-[(4-ethylphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 3707100 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | N-butan-2-yl-5-[(4-ethylphenyl)carbamoylamino]-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCc1ccc(NC(=O)Nc2ccc(N3CCCC3)c(C(=O)NC(C)CC)c2)cc1 |
| InChI | InChI=1S/C24H32N4O2/c1-4-17(3)25-23(29)21-16-20(12-13-22(21)28-14-6-7-15-28)27-24(30)26-19-10-8-18(5-2)9-11-19/h8-13,16-17H,4-7,14-15H2,1-3H3,(H,25,29)(H2,26,27,30) |
| InChIKey | ISRRTADDAJNMKZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|