C28H30N4O4 — CID 46326408
ethyl 2-[[5-[(4-methylbenzoyl)amino]-2-pyrrolidin-1-ylphenyl]carbamoylamino]benzoate (PubChem CID 46326408) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is ethyl 2-[[5-[(4-methylbenzoyl)amino]-2-pyrrolidin-1-ylphenyl]carbamoylamino]benzoate.
| Compound Name | ethyl 2-[[5-[(4-methylbenzoyl)amino]-2-pyrrolidin-1-ylphenyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 46326408 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | ethyl 2-[[5-[(4-methylbenzoyl)amino]-2-pyrrolidin-1-ylphenyl]carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)Nc1cc(NC(=O)c2ccc(C)cc2)ccc1N1CCCC1 |
| InChI | InChI=1S/C28H30N4O4/c1-3-36-27(34)22-8-4-5-9-23(22)30-28(35)31-24-18-21(14-15-25(24)32-16-6-7-17-32)29-26(33)20-12-10-19(2)11-13-20/h4-5,8-15,18H,3,6-7,16-17H2,1-2H3,(H,29,33)(H2,30,31,35) |
| InChIKey | QHRJBVACUYEIDU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|