C27H29ClN4O2 — CID 46326600
2-chloro-N-[3-[(2,4-dimethylphenyl)carbamoylamino]-4-piperidin-1-ylphenyl]benzamide (PubChem CID 46326600) has the molecular formula C27H29ClN4O2 and a molecular weight of 477.01 g/mol. Its IUPAC name is 2-chloro-N-[3-[(2,4-dimethylphenyl)carbamoylamino]-4-piperidin-1-ylphenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[(2,4-dimethylphenyl)carbamoylamino]-4-piperidin-1-ylphenyl]benzamide |
|---|---|
| PubChem CID | 46326600 |
| Molecular Formula | C27H29ClN4O2 |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 2-chloro-N-[3-[(2,4-dimethylphenyl)carbamoylamino]-4-piperidin-1-ylphenyl]benzamide |
| SMILES | Cc1ccc(NC(=O)Nc2cc(NC(=O)c3ccccc3Cl)ccc2N2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C27H29ClN4O2/c1-18-10-12-23(19(2)16-18)30-27(34)31-24-17-20(11-13-25(24)32-14-6-3-7-15-32)29-26(33)21-8-4-5-9-22(21)28/h4-5,8-13,16-17H,3,6-7,14-15H2,1-2H3,(H,29,33)(H2,30,31,34) |
| InChIKey | OKSPUEZNENVDFP-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|