C22H30N4O3+2 — CID 7221705
N-[[(2R)-4-benzylmorpholin-4-ium-2-yl]methyl]-6-morpholin-4-ylpyridin-1-ium-3-carboxamide (PubChem CID 7221705) has the molecular formula C22H30N4O3+2 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[[(2R)-4-benzylmorpholin-4-ium-2-yl]methyl]-6-morpholin-4-ylpyridin-1-ium-3-carboxamide.
| Compound Name | N-[[(2R)-4-benzylmorpholin-4-ium-2-yl]methyl]-6-morpholin-4-ylpyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 7221705 |
| Molecular Formula | C22H30N4O3+2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-[[(2R)-4-benzylmorpholin-4-ium-2-yl]methyl]-6-morpholin-4-ylpyridin-1-ium-3-carboxamide |
| SMILES | O=C(NC[C@@H]1C[NH+](Cc2ccccc2)CCO1)c1ccc(N2CCOCC2)[nH+]c1 |
| InChI | InChI=1S/C22H28N4O3/c27-22(19-6-7-21(23-14-19)26-9-11-28-12-10-26)24-15-20-17-25(8-13-29-20)16-18-4-2-1-3-5-18/h1-7,14,20H,8-13,15-17H2,(H,24,27)/p+2/t20-/m1/s1 |
| InChIKey | YPPOMKOXHOQTCK-HXUWFJFHSA-P |
| XLogP | -0.45 |
| TPSA | 69.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |