C26H27N2O3+ — CID 8504065
N-[[(2S)-4-benzylmorpholin-4-ium-2-yl]methyl]-9H-xanthene-9-carboxamide (PubChem CID 8504065) has the molecular formula C26H27N2O3+ and a molecular weight of 415.51 g/mol. Its IUPAC name is N-[[(2S)-4-benzylmorpholin-4-ium-2-yl]methyl]-9H-xanthene-9-carboxamide.
| Compound Name | N-[[(2S)-4-benzylmorpholin-4-ium-2-yl]methyl]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 8504065 |
| Molecular Formula | C26H27N2O3+ |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-[[(2S)-4-benzylmorpholin-4-ium-2-yl]methyl]-9H-xanthene-9-carboxamide |
| SMILES | O=C(NC[C@H]1C[NH+](Cc2ccccc2)CCO1)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C26H26N2O3/c29-26(25-21-10-4-6-12-23(21)31-24-13-7-5-11-22(24)25)27-16-20-18-28(14-15-30-20)17-19-8-2-1-3-9-19/h1-13,20,25H,14-18H2,(H,27,29)/p+1/t20-/m0/s1 |
| InChIKey | ZSVPTLLXMNUDSL-FQEVSTJZSA-O |
| XLogP | 2.52 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |