C20H22N2O3 — CID 94825344
N-[[(2S)-4-methylmorpholin-2-yl]methyl]-9H-xanthene-9-carboxamide (PubChem CID 94825344) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[[(2S)-4-methylmorpholin-2-yl]methyl]-9H-xanthene-9-carboxamide.
| Compound Name | N-[[(2S)-4-methylmorpholin-2-yl]methyl]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 94825344 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[[(2S)-4-methylmorpholin-2-yl]methyl]-9H-xanthene-9-carboxamide |
| SMILES | CN1CCO[C@@H](CNC(=O)C2c3ccccc3Oc3ccccc32)C1 |
| InChI | InChI=1S/C20H22N2O3/c1-22-10-11-24-14(13-22)12-21-20(23)19-15-6-2-4-8-17(15)25-18-9-5-3-7-16(18)19/h2-9,14,19H,10-13H2,1H3,(H,21,23)/t14-/m0/s1 |
| InChIKey | KFGNINMIQOHQJE-AWEZNQCLSA-N |
| XLogP | 2.37 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |