C19H22ClFN3OS+ — CID 9094566
1-[[(2R)-4-benzylmorpholin-4-ium-2-yl]methyl]-3-(3-chloro-4-fluorophenyl)thiourea (PubChem CID 9094566) has the molecular formula C19H22ClFN3OS+ and a molecular weight of 394.92 g/mol. Its IUPAC name is 1-[[(2R)-4-benzylmorpholin-4-ium-2-yl]methyl]-3-(3-chloro-4-fluorophenyl)thiourea.
| Compound Name | 1-[[(2R)-4-benzylmorpholin-4-ium-2-yl]methyl]-3-(3-chloro-4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 9094566 |
| Molecular Formula | C19H22ClFN3OS+ |
| Molecular Weight | 394.92 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 1-[[(2R)-4-benzylmorpholin-4-ium-2-yl]methyl]-3-(3-chloro-4-fluorophenyl)thiourea |
| SMILES | Fc1ccc(NC(=S)NC[C@@H]2C[NH+](Cc3ccccc3)CCO2)cc1Cl |
| InChI | InChI=1S/C19H21ClFN3OS/c20-17-10-15(6-7-18(17)21)23-19(26)22-11-16-13-24(8-9-25-16)12-14-4-2-1-3-5-14/h1-7,10,16H,8-9,11-13H2,(H2,22,23,26)/p+1/t16-/m1/s1 |
| InChIKey | IEOIZURRCPJRIH-MRXNPFEDSA-O |
| XLogP | 2.25 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.92 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|