C16H24ClFN3OS+ — CID 9283770
1-(3-chloro-4-fluorophenyl)-3-[[(2S)-4-(2-methylpropyl)morpholin-4-ium-2-yl]methyl]thiourea (PubChem CID 9283770) has the molecular formula C16H24ClFN3OS+ and a molecular weight of 360.91 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[[(2S)-4-(2-methylpropyl)morpholin-4-ium-2-yl]methyl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[[(2S)-4-(2-methylpropyl)morpholin-4-ium-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 9283770 |
| Molecular Formula | C16H24ClFN3OS+ |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[[(2S)-4-(2-methylpropyl)morpholin-4-ium-2-yl]methyl]thiourea |
| SMILES | CC(C)C[NH+]1CCO[C@@H](CNC(=S)Nc2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H23ClFN3OS/c1-11(2)9-21-5-6-22-13(10-21)8-19-16(23)20-12-3-4-15(18)14(17)7-12/h3-4,7,11,13H,5-6,8-10H2,1-2H3,(H2,19,20,23)/p+1/t13-/m0/s1 |
| InChIKey | JZSPNKBYDSVXMU-ZDUSSCGKSA-O |
| XLogP | 1.71 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|