C19H20N3O2S+ — CID 6976162
N-(1-benzothiophen-2-ylmethyl)-6-morpholin-4-ylpyridin-1-ium-3-carboxamide (PubChem CID 6976162) has the molecular formula C19H20N3O2S+ and a molecular weight of 354.46 g/mol. Its IUPAC name is N-(1-benzothiophen-2-ylmethyl)-6-morpholin-4-ylpyridin-1-ium-3-carboxamide.
| Compound Name | N-(1-benzothiophen-2-ylmethyl)-6-morpholin-4-ylpyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 6976162 |
| Molecular Formula | C19H20N3O2S+ |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | N-(1-benzothiophen-2-ylmethyl)-6-morpholin-4-ylpyridin-1-ium-3-carboxamide |
| SMILES | O=C(NCc1cc2ccccc2s1)c1ccc(N2CCOCC2)[nH+]c1 |
| InChI | InChI=1S/C19H19N3O2S/c23-19(21-13-16-11-14-3-1-2-4-17(14)25-16)15-5-6-18(20-12-15)22-7-9-24-10-8-22/h1-6,11-12H,7-10,13H2,(H,21,23)/p+1 |
| InChIKey | JJJXXRUMARPFJE-UHFFFAOYSA-O |
| XLogP | 2.48 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |