C21H27N5O2 — CID 109083518
4-N-[2-(dimethylamino)ethyl]-2-N-(4-pyrrolidin-1-ylphenyl)pyridine-2,4-dicarboxamide (PubChem CID 109083518) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-N-[2-(dimethylamino)ethyl]-2-N-(4-pyrrolidin-1-ylphenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-[2-(dimethylamino)ethyl]-2-N-(4-pyrrolidin-1-ylphenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109083518 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 4-N-[2-(dimethylamino)ethyl]-2-N-(4-pyrrolidin-1-ylphenyl)pyridine-2,4-dicarboxamide |
| SMILES | CN(C)CCNC(=O)c1ccnc(C(=O)Nc2ccc(N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C21H27N5O2/c1-25(2)14-11-23-20(27)16-9-10-22-19(15-16)21(28)24-17-5-7-18(8-6-17)26-12-3-4-13-26/h5-10,15H,3-4,11-14H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | VXBAZYYCKJDHBF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|