C22H29N5O2 — CID 109079711
2-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-N-(2-methylpropyl)pyridine-2,4-dicarboxamide (PubChem CID 109079711) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-N-(2-methylpropyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-N-(2-methylpropyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109079711 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 2-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-N-(2-methylpropyl)pyridine-2,4-dicarboxamide |
| SMILES | CC(C)CNC(=O)c1ccnc(C(=O)Nc2ccc(N3CCN(C)CC3)cc2)c1 |
| InChI | InChI=1S/C22H29N5O2/c1-16(2)15-24-21(28)17-8-9-23-20(14-17)22(29)25-18-4-6-19(7-5-18)27-12-10-26(3)11-13-27/h4-9,14,16H,10-13,15H2,1-3H3,(H,24,28)(H,25,29) |
| InChIKey | PYGHUTOUMZSNBR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|