C22H29N5O2 — CID 109088980
2-N,2-N-diethyl-4-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-2,4-dicarboxamide (PubChem CID 109088980) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-N,2-N-diethyl-4-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-2,4-dicarboxamide.
| Compound Name | 2-N,2-N-diethyl-4-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109088980 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 2-N,2-N-diethyl-4-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-2,4-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1cc(C(=O)Nc2ccc(N3CCN(C)CC3)cc2)ccn1 |
| InChI | InChI=1S/C22H29N5O2/c1-4-26(5-2)22(29)20-16-17(10-11-23-20)21(28)24-18-6-8-19(9-7-18)27-14-12-25(3)13-15-27/h6-11,16H,4-5,12-15H2,1-3H3,(H,24,28) |
| InChIKey | VVMZFGJFDAGMPE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|