C19H22N4O3 — CID 109088967
4-N-(3-acetamidophenyl)-2-N,2-N-diethylpyridine-2,4-dicarboxamide (PubChem CID 109088967) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 4-N-(3-acetamidophenyl)-2-N,2-N-diethylpyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(3-acetamidophenyl)-2-N,2-N-diethylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109088967 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 4-N-(3-acetamidophenyl)-2-N,2-N-diethylpyridine-2,4-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1cc(C(=O)Nc2cccc(NC(C)=O)c2)ccn1 |
| InChI | InChI=1S/C19H22N4O3/c1-4-23(5-2)19(26)17-11-14(9-10-20-17)18(25)22-16-8-6-7-15(12-16)21-13(3)24/h6-12H,4-5H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | GUDJUVUXADGSEI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |