C20H26N4O2 — CID 109218356
4-(3-acetamidoanilino)-N,N-dipropylpyridine-2-carboxamide (PubChem CID 109218356) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-(3-acetamidoanilino)-N,N-dipropylpyridine-2-carboxamide.
| Compound Name | 4-(3-acetamidoanilino)-N,N-dipropylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109218356 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 4-(3-acetamidoanilino)-N,N-dipropylpyridine-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(Nc2cccc(NC(C)=O)c2)ccn1 |
| InChI | InChI=1S/C20H26N4O2/c1-4-11-24(12-5-2)20(26)19-14-18(9-10-21-19)23-17-8-6-7-16(13-17)22-15(3)25/h6-10,13-14H,4-5,11-12H2,1-3H3,(H,21,23)(H,22,25) |
| InChIKey | NNPBFPGUTBICJU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |