C20H27N3O3 — CID 109218350
4-(3,4-dimethoxyanilino)-N,N-dipropylpyridine-2-carboxamide (PubChem CID 109218350) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 4-(3,4-dimethoxyanilino)-N,N-dipropylpyridine-2-carboxamide.
| Compound Name | 4-(3,4-dimethoxyanilino)-N,N-dipropylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109218350 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 4-(3,4-dimethoxyanilino)-N,N-dipropylpyridine-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(Nc2ccc(OC)c(OC)c2)ccn1 |
| InChI | InChI=1S/C20H27N3O3/c1-5-11-23(12-6-2)20(24)17-13-16(9-10-21-17)22-15-7-8-18(25-3)19(14-15)26-4/h7-10,13-14H,5-6,11-12H2,1-4H3,(H,21,22) |
| InChIKey | BOSCRNHXWMLDJN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |