C20H28N4O — CID 109218362
4-[4-(dimethylamino)anilino]-N,N-dipropylpyridine-2-carboxamide (PubChem CID 109218362) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is 4-[4-(dimethylamino)anilino]-N,N-dipropylpyridine-2-carboxamide.
| Compound Name | 4-[4-(dimethylamino)anilino]-N,N-dipropylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109218362 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 4-[4-(dimethylamino)anilino]-N,N-dipropylpyridine-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(Nc2ccc(N(C)C)cc2)ccn1 |
| InChI | InChI=1S/C20H28N4O/c1-5-13-24(14-6-2)20(25)19-15-17(11-12-21-19)22-16-7-9-18(10-8-16)23(3)4/h7-12,15H,5-6,13-14H2,1-4H3,(H,21,22) |
| InChIKey | DZMYVLLACSNDPH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|