C18H21F2N3O — CID 109218386
4-(2,6-difluoroanilino)-N,N-dipropylpyridine-2-carboxamide (PubChem CID 109218386) has the molecular formula C18H21F2N3O and a molecular weight of 333.38 g/mol. Its IUPAC name is 4-(2,6-difluoroanilino)-N,N-dipropylpyridine-2-carboxamide.
| Compound Name | 4-(2,6-difluoroanilino)-N,N-dipropylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109218386 |
| Molecular Formula | C18H21F2N3O |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 4-(2,6-difluoroanilino)-N,N-dipropylpyridine-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(Nc2c(F)cccc2F)ccn1 |
| InChI | InChI=1S/C18H21F2N3O/c1-3-10-23(11-4-2)18(24)16-12-13(8-9-21-16)22-17-14(19)6-5-7-15(17)20/h5-9,12H,3-4,10-11H2,1-2H3,(H,21,22) |
| InChIKey | IBCDBIWUOAAKOP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |