C19H24ClN3O — CID 109211884
4-[(4-chlorophenyl)methylamino]-N,N-dipropylpyridine-2-carboxamide (PubChem CID 109211884) has the molecular formula C19H24ClN3O and a molecular weight of 345.87 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methylamino]-N,N-dipropylpyridine-2-carboxamide.
| Compound Name | 4-[(4-chlorophenyl)methylamino]-N,N-dipropylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109211884 |
| Molecular Formula | C19H24ClN3O |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 4-[(4-chlorophenyl)methylamino]-N,N-dipropylpyridine-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(NCc2ccc(Cl)cc2)ccn1 |
| InChI | InChI=1S/C19H24ClN3O/c1-3-11-23(12-4-2)19(24)18-13-17(9-10-21-18)22-14-15-5-7-16(20)8-6-15/h5-10,13H,3-4,11-12,14H2,1-2H3,(H,21,22) |
| InChIKey | GOCTVRRFHOTWGL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |